C21H22N4O4 — CID 95196915
(5S)-3-(1,3-benzodioxol-5-ylmethyl)-5-piperidin-4-yl-5-pyridin-3-ylimidazolidine-2,4-dione (PubChem CID 95196915) has the molecular formula C21H22N4O4 and a molecular weight of 394.43 g/mol. Its IUPAC name is (5S)-3-(1,3-benzodioxol-5-ylmethyl)-5-piperidin-4-yl-5-pyridin-3-ylimidazolidine-2,4-dione.
| Compound Name | (5S)-3-(1,3-benzodioxol-5-ylmethyl)-5-piperidin-4-yl-5-pyridin-3-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 95196915 |
| Molecular Formula | C21H22N4O4 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | (5S)-3-(1,3-benzodioxol-5-ylmethyl)-5-piperidin-4-yl-5-pyridin-3-ylimidazolidine-2,4-dione |
| SMILES | O=C1N[C@](c2cccnc2)(C2CCNCC2)C(=O)N1Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H22N4O4/c26-19-21(15-5-8-22-9-6-15,16-2-1-7-23-11-16)24-20(27)25(19)12-14-3-4-17-18(10-14)29-13-28-17/h1-4,7,10-11,15,22H,5-6,8-9,12-13H2,(H,24,27)/t21-/m0/s1 |
| InChIKey | DSMLKYQJQZWCMP-NRFANRHFSA-N |
| XLogP | 1.76 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|