C15H18F2N4O2 — CID 95200931
(5R)-3-(2,2-difluoroethyl)-5-piperidin-4-yl-5-pyridin-3-ylimidazolidine-2,4-dione (PubChem CID 95200931) has the molecular formula C15H18F2N4O2 and a molecular weight of 324.33 g/mol. Its IUPAC name is (5R)-3-(2,2-difluoroethyl)-5-piperidin-4-yl-5-pyridin-3-ylimidazolidine-2,4-dione.
| Compound Name | (5R)-3-(2,2-difluoroethyl)-5-piperidin-4-yl-5-pyridin-3-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 95200931 |
| Molecular Formula | C15H18F2N4O2 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | (5R)-3-(2,2-difluoroethyl)-5-piperidin-4-yl-5-pyridin-3-ylimidazolidine-2,4-dione |
| SMILES | O=C1N[C@@](c2cccnc2)(C2CCNCC2)C(=O)N1CC(F)F |
| InChI | InChI=1S/C15H18F2N4O2/c16-12(17)9-21-13(22)15(20-14(21)23,10-3-6-18-7-4-10)11-2-1-5-19-8-11/h1-2,5,8,10,12,18H,3-4,6-7,9H2,(H,20,23)/t15-/m1/s1 |
| InChIKey | UQNICMFFDBCXQK-OAHLLOKOSA-N |
| XLogP | 1.09 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|