C26H25FN4O3S — CID 42277490
(5S)-5-[1-(2-fluorobenzoyl)piperidin-4-yl]-5-pyridin-3-yl-3-(2-thiophen-2-ylethyl)imidazolidine-2,4-dione (PubChem CID 42277490) has the molecular formula C26H25FN4O3S and a molecular weight of 492.58 g/mol. Its IUPAC name is (5S)-5-[1-(2-fluorobenzoyl)piperidin-4-yl]-5-pyridin-3-yl-3-(2-thiophen-2-ylethyl)imidazolidine-2,4-dione.
| Compound Name | (5S)-5-[1-(2-fluorobenzoyl)piperidin-4-yl]-5-pyridin-3-yl-3-(2-thiophen-2-ylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42277490 |
| Molecular Formula | C26H25FN4O3S |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | (5S)-5-[1-(2-fluorobenzoyl)piperidin-4-yl]-5-pyridin-3-yl-3-(2-thiophen-2-ylethyl)imidazolidine-2,4-dione |
| SMILES | O=C(c1ccccc1F)N1CCC([C@@]2(c3cccnc3)NC(=O)N(CCc3cccs3)C2=O)CC1 |
| InChI | InChI=1S/C26H25FN4O3S/c27-22-8-2-1-7-21(22)23(32)30-13-9-18(10-14-30)26(19-5-3-12-28-17-19)24(33)31(25(34)29-26)15-11-20-6-4-16-35-20/h1-8,12,16-18H,9-11,13-15H2,(H,29,34)/t26-/m0/s1 |
| InChIKey | WCEDRCFNWZODBK-SANMLTNESA-N |
| XLogP | 3.82 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|