C25H28N4O3S — CID 42472790
(5R)-5-[1-(cyclopentene-1-carbonyl)piperidin-4-yl]-5-pyridin-2-yl-3-(2-thiophen-2-ylethyl)imidazolidine-2,4-dione (PubChem CID 42472790) has the molecular formula C25H28N4O3S and a molecular weight of 464.59 g/mol. Its IUPAC name is (5R)-5-[1-(cyclopentene-1-carbonyl)piperidin-4-yl]-5-pyridin-2-yl-3-(2-thiophen-2-ylethyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[1-(cyclopentene-1-carbonyl)piperidin-4-yl]-5-pyridin-2-yl-3-(2-thiophen-2-ylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42472790 |
| Molecular Formula | C25H28N4O3S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | (5R)-5-[1-(cyclopentene-1-carbonyl)piperidin-4-yl]-5-pyridin-2-yl-3-(2-thiophen-2-ylethyl)imidazolidine-2,4-dione |
| SMILES | O=C(C1=CCCC1)N1CCC([C@]2(c3ccccn3)NC(=O)N(CCc3cccs3)C2=O)CC1 |
| InChI | InChI=1S/C25H28N4O3S/c30-22(18-6-1-2-7-18)28-14-10-19(11-15-28)25(21-9-3-4-13-26-21)23(31)29(24(32)27-25)16-12-20-8-5-17-33-20/h3-6,8-9,13,17,19H,1-2,7,10-12,14-16H2,(H,27,32)/t25-/m1/s1 |
| InChIKey | DLTLZLYSUOIOSZ-RUZDIDTESA-N |
| XLogP | 3.48 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|