C28H32N4O2S — CID 45247531
5-[1-[(3,5-dimethylphenyl)methyl]piperidin-4-yl]-5-pyridin-2-yl-3-(2-thiophen-2-ylethyl)imidazolidine-2,4-dione (PubChem CID 45247531) has the molecular formula C28H32N4O2S and a molecular weight of 488.66 g/mol. Its IUPAC name is 5-[1-[(3,5-dimethylphenyl)methyl]piperidin-4-yl]-5-pyridin-2-yl-3-(2-thiophen-2-ylethyl)imidazolidine-2,4-dione.
| Compound Name | 5-[1-[(3,5-dimethylphenyl)methyl]piperidin-4-yl]-5-pyridin-2-yl-3-(2-thiophen-2-ylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 45247531 |
| Molecular Formula | C28H32N4O2S |
| Molecular Weight | 488.66 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | 5-[1-[(3,5-dimethylphenyl)methyl]piperidin-4-yl]-5-pyridin-2-yl-3-(2-thiophen-2-ylethyl)imidazolidine-2,4-dione |
| SMILES | Cc1cc(C)cc(CN2CCC(C3(c4ccccn4)NC(=O)N(CCc4cccs4)C3=O)CC2)c1 |
| InChI | InChI=1S/C28H32N4O2S/c1-20-16-21(2)18-22(17-20)19-31-12-8-23(9-13-31)28(25-7-3-4-11-29-25)26(33)32(27(34)30-28)14-10-24-6-5-15-35-24/h3-7,11,15-18,23H,8-10,12-14,19H2,1-2H3,(H,30,34) |
| InChIKey | LJZGXCAKJLBKHP-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.66 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|