C25H28F2N4O3 — CID 45180616
5-[1-[(3,5-difluorophenyl)methyl]piperidin-4-yl]-3-(oxolan-2-ylmethyl)-5-pyridin-2-ylimidazolidine-2,4-dione (PubChem CID 45180616) has the molecular formula C25H28F2N4O3 and a molecular weight of 470.52 g/mol. Its IUPAC name is 5-[1-[(3,5-difluorophenyl)methyl]piperidin-4-yl]-3-(oxolan-2-ylmethyl)-5-pyridin-2-ylimidazolidine-2,4-dione.
| Compound Name | 5-[1-[(3,5-difluorophenyl)methyl]piperidin-4-yl]-3-(oxolan-2-ylmethyl)-5-pyridin-2-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 45180616 |
| Molecular Formula | C25H28F2N4O3 |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | 5-[1-[(3,5-difluorophenyl)methyl]piperidin-4-yl]-3-(oxolan-2-ylmethyl)-5-pyridin-2-ylimidazolidine-2,4-dione |
| SMILES | O=C1NC(c2ccccn2)(C2CCN(Cc3cc(F)cc(F)c3)CC2)C(=O)N1CC1CCCO1 |
| InChI | InChI=1S/C25H28F2N4O3/c26-19-12-17(13-20(27)14-19)15-30-9-6-18(7-10-30)25(22-5-1-2-8-28-22)23(32)31(24(33)29-25)16-21-4-3-11-34-21/h1-2,5,8,12-14,18,21H,3-4,6-7,9-11,15-16H2,(H,29,33) |
| InChIKey | ZMFAVTRFWDUGBU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|