C26H29ClN4O4 — CID 45233140
5-[1-[2-(4-chlorophenyl)acetyl]piperidin-4-yl]-3-(oxolan-2-ylmethyl)-5-pyridin-2-ylimidazolidine-2,4-dione (PubChem CID 45233140) has the molecular formula C26H29ClN4O4 and a molecular weight of 497.00 g/mol. Its IUPAC name is 5-[1-[2-(4-chlorophenyl)acetyl]piperidin-4-yl]-3-(oxolan-2-ylmethyl)-5-pyridin-2-ylimidazolidine-2,4-dione.
| Compound Name | 5-[1-[2-(4-chlorophenyl)acetyl]piperidin-4-yl]-3-(oxolan-2-ylmethyl)-5-pyridin-2-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 45233140 |
| Molecular Formula | C26H29ClN4O4 |
| Molecular Weight | 497.00 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | 5-[1-[2-(4-chlorophenyl)acetyl]piperidin-4-yl]-3-(oxolan-2-ylmethyl)-5-pyridin-2-ylimidazolidine-2,4-dione |
| SMILES | O=C(Cc1ccc(Cl)cc1)N1CCC(C2(c3ccccn3)NC(=O)N(CC3CCCO3)C2=O)CC1 |
| InChI | InChI=1S/C26H29ClN4O4/c27-20-8-6-18(7-9-20)16-23(32)30-13-10-19(11-14-30)26(22-5-1-2-12-28-22)24(33)31(25(34)29-26)17-21-4-3-15-35-21/h1-2,5-9,12,19,21H,3-4,10-11,13-17H2,(H,29,34) |
| InChIKey | JFRFSBJZWXWPSM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.00 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|