C26H28F2N4O4 — CID 45230238
5-[1-[2-(2,3-difluorophenyl)acetyl]piperidin-4-yl]-3-(oxolan-2-ylmethyl)-5-pyridin-2-ylimidazolidine-2,4-dione (PubChem CID 45230238) has the molecular formula C26H28F2N4O4 and a molecular weight of 498.53 g/mol. Its IUPAC name is 5-[1-[2-(2,3-difluorophenyl)acetyl]piperidin-4-yl]-3-(oxolan-2-ylmethyl)-5-pyridin-2-ylimidazolidine-2,4-dione.
| Compound Name | 5-[1-[2-(2,3-difluorophenyl)acetyl]piperidin-4-yl]-3-(oxolan-2-ylmethyl)-5-pyridin-2-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 45230238 |
| Molecular Formula | C26H28F2N4O4 |
| Molecular Weight | 498.53 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | 5-[1-[2-(2,3-difluorophenyl)acetyl]piperidin-4-yl]-3-(oxolan-2-ylmethyl)-5-pyridin-2-ylimidazolidine-2,4-dione |
| SMILES | O=C(Cc1cccc(F)c1F)N1CCC(C2(c3ccccn3)NC(=O)N(CC3CCCO3)C2=O)CC1 |
| InChI | InChI=1S/C26H28F2N4O4/c27-20-7-3-5-17(23(20)28)15-22(33)31-12-9-18(10-13-31)26(21-8-1-2-11-29-21)24(34)32(25(35)30-26)16-19-6-4-14-36-19/h1-3,5,7-8,11,18-19H,4,6,9-10,12-16H2,(H,30,35) |
| InChIKey | YAVAPXBYILIOKW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.53 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|