C24H28N4O4S — CID 45197451
3-(oxolan-2-ylmethyl)-5-pyridin-2-yl-5-[1-(2-thiophen-2-ylacetyl)piperidin-4-yl]imidazolidine-2,4-dione (PubChem CID 45197451) has the molecular formula C24H28N4O4S and a molecular weight of 468.58 g/mol. Its IUPAC name is 3-(oxolan-2-ylmethyl)-5-pyridin-2-yl-5-[1-(2-thiophen-2-ylacetyl)piperidin-4-yl]imidazolidine-2,4-dione.
| Compound Name | 3-(oxolan-2-ylmethyl)-5-pyridin-2-yl-5-[1-(2-thiophen-2-ylacetyl)piperidin-4-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 45197451 |
| Molecular Formula | C24H28N4O4S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 3-(oxolan-2-ylmethyl)-5-pyridin-2-yl-5-[1-(2-thiophen-2-ylacetyl)piperidin-4-yl]imidazolidine-2,4-dione |
| SMILES | O=C(Cc1cccs1)N1CCC(C2(c3ccccn3)NC(=O)N(CC3CCCO3)C2=O)CC1 |
| InChI | InChI=1S/C24H28N4O4S/c29-21(15-19-6-4-14-33-19)27-11-8-17(9-12-27)24(20-7-1-2-10-25-20)22(30)28(23(31)26-24)16-18-5-3-13-32-18/h1-2,4,6-7,10,14,17-18H,3,5,8-9,11-13,15-16H2,(H,26,31) |
| InChIKey | OAVGYUCCVBCSJE-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|