C27H34N4O3 — CID 42438417
(5S)-3-[[(2R)-oxolan-2-yl]methyl]-5-[1-(3-phenylpropyl)piperidin-4-yl]-5-pyridin-2-ylimidazolidine-2,4-dione (PubChem CID 42438417) has the molecular formula C27H34N4O3 and a molecular weight of 462.59 g/mol. Its IUPAC name is (5S)-3-[[(2R)-oxolan-2-yl]methyl]-5-[1-(3-phenylpropyl)piperidin-4-yl]-5-pyridin-2-ylimidazolidine-2,4-dione.
| Compound Name | (5S)-3-[[(2R)-oxolan-2-yl]methyl]-5-[1-(3-phenylpropyl)piperidin-4-yl]-5-pyridin-2-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42438417 |
| Molecular Formula | C27H34N4O3 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | (5S)-3-[[(2R)-oxolan-2-yl]methyl]-5-[1-(3-phenylpropyl)piperidin-4-yl]-5-pyridin-2-ylimidazolidine-2,4-dione |
| SMILES | O=C1N[C@](c2ccccn2)(C2CCN(CCCc3ccccc3)CC2)C(=O)N1C[C@H]1CCCO1 |
| InChI | InChI=1S/C27H34N4O3/c32-25-27(24-12-4-5-15-28-24,29-26(33)31(25)20-23-11-7-19-34-23)22-13-17-30(18-14-22)16-6-10-21-8-2-1-3-9-21/h1-5,8-9,12,15,22-23H,6-7,10-11,13-14,16-20H2,(H,29,33)/t23-,27+/m1/s1 |
| InChIKey | APQXHVNPHTVCDJ-KCWPFWIISA-N |
| XLogP | 3.35 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|