C27H30N4O2S — CID 42277499
(5R)-5-[1-[(2-methylphenyl)methyl]piperidin-4-yl]-5-pyridin-2-yl-3-(2-thiophen-2-ylethyl)imidazolidine-2,4-dione (PubChem CID 42277499) has the molecular formula C27H30N4O2S and a molecular weight of 474.63 g/mol. Its IUPAC name is (5R)-5-[1-[(2-methylphenyl)methyl]piperidin-4-yl]-5-pyridin-2-yl-3-(2-thiophen-2-ylethyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[1-[(2-methylphenyl)methyl]piperidin-4-yl]-5-pyridin-2-yl-3-(2-thiophen-2-ylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42277499 |
| Molecular Formula | C27H30N4O2S |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | (5R)-5-[1-[(2-methylphenyl)methyl]piperidin-4-yl]-5-pyridin-2-yl-3-(2-thiophen-2-ylethyl)imidazolidine-2,4-dione |
| SMILES | Cc1ccccc1CN1CCC([C@]2(c3ccccn3)NC(=O)N(CCc3cccs3)C2=O)CC1 |
| InChI | InChI=1S/C27H30N4O2S/c1-20-7-2-3-8-21(20)19-30-15-11-22(12-16-30)27(24-10-4-5-14-28-24)25(32)31(26(33)29-27)17-13-23-9-6-18-34-23/h2-10,14,18,22H,11-13,15-17,19H2,1H3,(H,29,33)/t27-/m1/s1 |
| InChIKey | MCPVXMKHBTWYQE-HHHXNRCGSA-N |
| XLogP | 4.35 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|