C26H27FN4O3 — CID 45218943
5-[1-(cyclopentene-1-carbonyl)piperidin-4-yl]-3-[(4-fluorophenyl)methyl]-5-pyridin-3-ylimidazolidine-2,4-dione (PubChem CID 45218943) has the molecular formula C26H27FN4O3 and a molecular weight of 462.53 g/mol. Its IUPAC name is 5-[1-(cyclopentene-1-carbonyl)piperidin-4-yl]-3-[(4-fluorophenyl)methyl]-5-pyridin-3-ylimidazolidine-2,4-dione.
| Compound Name | 5-[1-(cyclopentene-1-carbonyl)piperidin-4-yl]-3-[(4-fluorophenyl)methyl]-5-pyridin-3-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 45218943 |
| Molecular Formula | C26H27FN4O3 |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | 5-[1-(cyclopentene-1-carbonyl)piperidin-4-yl]-3-[(4-fluorophenyl)methyl]-5-pyridin-3-ylimidazolidine-2,4-dione |
| SMILES | O=C(C1=CCCC1)N1CCC(C2(c3cccnc3)NC(=O)N(Cc3ccc(F)cc3)C2=O)CC1 |
| InChI | InChI=1S/C26H27FN4O3/c27-22-9-7-18(8-10-22)17-31-24(33)26(29-25(31)34,21-6-3-13-28-16-21)20-11-14-30(15-12-20)23(32)19-4-1-2-5-19/h3-4,6-10,13,16,20H,1-2,5,11-12,14-15,17H2,(H,29,34) |
| InChIKey | VTWRXHUVVHVNSE-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|