C25H22F2N4O3S — CID 45177279
5-[1-(3,5-difluorobenzoyl)piperidin-4-yl]-5-pyridin-3-yl-3-(thiophen-3-ylmethyl)imidazolidine-2,4-dione (PubChem CID 45177279) has the molecular formula C25H22F2N4O3S and a molecular weight of 496.54 g/mol. Its IUPAC name is 5-[1-(3,5-difluorobenzoyl)piperidin-4-yl]-5-pyridin-3-yl-3-(thiophen-3-ylmethyl)imidazolidine-2,4-dione.
| Compound Name | 5-[1-(3,5-difluorobenzoyl)piperidin-4-yl]-5-pyridin-3-yl-3-(thiophen-3-ylmethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 45177279 |
| Molecular Formula | C25H22F2N4O3S |
| Molecular Weight | 496.54 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | 5-[1-(3,5-difluorobenzoyl)piperidin-4-yl]-5-pyridin-3-yl-3-(thiophen-3-ylmethyl)imidazolidine-2,4-dione |
| SMILES | O=C(c1cc(F)cc(F)c1)N1CCC(C2(c3cccnc3)NC(=O)N(Cc3ccsc3)C2=O)CC1 |
| InChI | InChI=1S/C25H22F2N4O3S/c26-20-10-17(11-21(27)12-20)22(32)30-7-3-18(4-8-30)25(19-2-1-6-28-13-19)23(33)31(24(34)29-25)14-16-5-9-35-15-16/h1-2,5-6,9-13,15,18H,3-4,7-8,14H2,(H,29,34) |
| InChIKey | GFVOTWFNMUFFNI-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.54 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|