C27H32N4O4 — CID 45170309
5-[1-(2,4-dimethylbenzoyl)piperidin-4-yl]-3-(oxolan-2-ylmethyl)-5-pyridin-3-ylimidazolidine-2,4-dione (PubChem CID 45170309) has the molecular formula C27H32N4O4 and a molecular weight of 476.58 g/mol. Its IUPAC name is 5-[1-(2,4-dimethylbenzoyl)piperidin-4-yl]-3-(oxolan-2-ylmethyl)-5-pyridin-3-ylimidazolidine-2,4-dione.
| Compound Name | 5-[1-(2,4-dimethylbenzoyl)piperidin-4-yl]-3-(oxolan-2-ylmethyl)-5-pyridin-3-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 45170309 |
| Molecular Formula | C27H32N4O4 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | 5-[1-(2,4-dimethylbenzoyl)piperidin-4-yl]-3-(oxolan-2-ylmethyl)-5-pyridin-3-ylimidazolidine-2,4-dione |
| SMILES | Cc1ccc(C(=O)N2CCC(C3(c4cccnc4)NC(=O)N(CC4CCCO4)C3=O)CC2)c(C)c1 |
| InChI | InChI=1S/C27H32N4O4/c1-18-7-8-23(19(2)15-18)24(32)30-12-9-20(10-13-30)27(21-5-3-11-28-16-21)25(33)31(26(34)29-27)17-22-6-4-14-35-22/h3,5,7-8,11,15-16,20,22H,4,6,9-10,12-14,17H2,1-2H3,(H,29,34) |
| InChIKey | BMISLYHHJFZWHV-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|