C18H29N5O2 — CID 95206967
(5R)-3-[2-(2-ethylimidazol-1-yl)ethyl]-5-piperidin-4-yl-5-propylimidazolidine-2,4-dione (PubChem CID 95206967) has the molecular formula C18H29N5O2 and a molecular weight of 347.46 g/mol. Its IUPAC name is (5R)-3-[2-(2-ethylimidazol-1-yl)ethyl]-5-piperidin-4-yl-5-propylimidazolidine-2,4-dione.
| Compound Name | (5R)-3-[2-(2-ethylimidazol-1-yl)ethyl]-5-piperidin-4-yl-5-propylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 95206967 |
| Molecular Formula | C18H29N5O2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.23 |
| IUPAC Name | (5R)-3-[2-(2-ethylimidazol-1-yl)ethyl]-5-piperidin-4-yl-5-propylimidazolidine-2,4-dione |
| SMILES | CCC[C@]1(C2CCNCC2)NC(=O)N(CCn2ccnc2CC)C1=O |
| InChI | InChI=1S/C18H29N5O2/c1-3-7-18(14-5-8-19-9-6-14)16(24)23(17(25)21-18)13-12-22-11-10-20-15(22)4-2/h10-11,14,19H,3-9,12-13H2,1-2H3,(H,21,25)/t18-/m1/s1 |
| InChIKey | UYSJLCUDHUSNBE-GOSISDBHSA-N |
| XLogP | 1.54 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|