C20H26N4O2 — CID 95223916
4-[2-[(4R)-2,5-dioxo-4-piperidin-4-yl-4-propylimidazolidin-1-yl]ethyl]benzonitrile (PubChem CID 95223916) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is 4-[2-[(4R)-2,5-dioxo-4-piperidin-4-yl-4-propylimidazolidin-1-yl]ethyl]benzonitrile.
| Compound Name | 4-[2-[(4R)-2,5-dioxo-4-piperidin-4-yl-4-propylimidazolidin-1-yl]ethyl]benzonitrile |
|---|---|
| PubChem CID | 95223916 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | 4-[2-[(4R)-2,5-dioxo-4-piperidin-4-yl-4-propylimidazolidin-1-yl]ethyl]benzonitrile |
| SMILES | CCC[C@]1(C2CCNCC2)NC(=O)N(CCc2ccc(C#N)cc2)C1=O |
| InChI | InChI=1S/C20H26N4O2/c1-2-10-20(17-7-11-22-12-8-17)18(25)24(19(26)23-20)13-9-15-3-5-16(14-21)6-4-15/h3-6,17,22H,2,7-13H2,1H3,(H,23,26)/t20-/m1/s1 |
| InChIKey | WLPYENSMUCUABO-HXUWFJFHSA-N |
| XLogP | 2.19 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|