C20H27N3O2 — CID 56720812
3-(cyclopropylmethyl)-5-(2-phenylethyl)-5-piperidin-4-ylimidazolidine-2,4-dione (PubChem CID 56720812) has the molecular formula C20H27N3O2 and a molecular weight of 341.45 g/mol. Its IUPAC name is 3-(cyclopropylmethyl)-5-(2-phenylethyl)-5-piperidin-4-ylimidazolidine-2,4-dione.
| Compound Name | 3-(cyclopropylmethyl)-5-(2-phenylethyl)-5-piperidin-4-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 56720812 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 3-(cyclopropylmethyl)-5-(2-phenylethyl)-5-piperidin-4-ylimidazolidine-2,4-dione |
| SMILES | O=C1NC(CCc2ccccc2)(C2CCNCC2)C(=O)N1CC1CC1 |
| InChI | InChI=1S/C20H27N3O2/c24-18-20(17-9-12-21-13-10-17,11-8-15-4-2-1-3-5-15)22-19(25)23(18)14-16-6-7-16/h1-5,16-17,21H,6-14H2,(H,22,25) |
| InChIKey | RTCALIMBBDHEDV-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|