C21H29N3O2 — CID 95209787
(5S)-3-cyclopentyl-5-(2-phenylethyl)-5-piperidin-4-ylimidazolidine-2,4-dione (PubChem CID 95209787) has the molecular formula C21H29N3O2 and a molecular weight of 355.48 g/mol. Its IUPAC name is (5S)-3-cyclopentyl-5-(2-phenylethyl)-5-piperidin-4-ylimidazolidine-2,4-dione.
| Compound Name | (5S)-3-cyclopentyl-5-(2-phenylethyl)-5-piperidin-4-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 95209787 |
| Molecular Formula | C21H29N3O2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | (5S)-3-cyclopentyl-5-(2-phenylethyl)-5-piperidin-4-ylimidazolidine-2,4-dione |
| SMILES | O=C1N[C@@](CCc2ccccc2)(C2CCNCC2)C(=O)N1C1CCCC1 |
| InChI | InChI=1S/C21H29N3O2/c25-19-21(17-11-14-22-15-12-17,13-10-16-6-2-1-3-7-16)23-20(26)24(19)18-8-4-5-9-18/h1-3,6-7,17-18,22H,4-5,8-15H2,(H,23,26)/t21-/m0/s1 |
| InChIKey | ZOYMBTCGPIIZNK-NRFANRHFSA-N |
| XLogP | 2.85 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|