C21H30N4O2 — CID 95220588
(5S)-5-benzyl-3-(1-methylpiperidin-4-yl)-5-piperidin-4-ylimidazolidine-2,4-dione (PubChem CID 95220588) has the molecular formula C21H30N4O2 and a molecular weight of 370.50 g/mol. Its IUPAC name is (5S)-5-benzyl-3-(1-methylpiperidin-4-yl)-5-piperidin-4-ylimidazolidine-2,4-dione.
| Compound Name | (5S)-5-benzyl-3-(1-methylpiperidin-4-yl)-5-piperidin-4-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 95220588 |
| Molecular Formula | C21H30N4O2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | (5S)-5-benzyl-3-(1-methylpiperidin-4-yl)-5-piperidin-4-ylimidazolidine-2,4-dione |
| SMILES | CN1CCC(N2C(=O)N[C@@](Cc3ccccc3)(C3CCNCC3)C2=O)CC1 |
| InChI | InChI=1S/C21H30N4O2/c1-24-13-9-18(10-14-24)25-19(26)21(23-20(25)27,17-7-11-22-12-8-17)15-16-5-3-2-4-6-16/h2-6,17-18,22H,7-15H2,1H3,(H,23,27)/t21-/m0/s1 |
| InChIKey | CYDNOVVTZDKJPB-NRFANRHFSA-N |
| XLogP | 1.61 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|