C24H27N3O2 — CID 95229978
(5R)-5-benzyl-3-(2,3-dihydro-1H-inden-2-yl)-5-piperidin-4-ylimidazolidine-2,4-dione (PubChem CID 95229978) has the molecular formula C24H27N3O2 and a molecular weight of 389.50 g/mol. Its IUPAC name is (5R)-5-benzyl-3-(2,3-dihydro-1H-inden-2-yl)-5-piperidin-4-ylimidazolidine-2,4-dione.
| Compound Name | (5R)-5-benzyl-3-(2,3-dihydro-1H-inden-2-yl)-5-piperidin-4-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 95229978 |
| Molecular Formula | C24H27N3O2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | (5R)-5-benzyl-3-(2,3-dihydro-1H-inden-2-yl)-5-piperidin-4-ylimidazolidine-2,4-dione |
| SMILES | O=C1N[C@](Cc2ccccc2)(C2CCNCC2)C(=O)N1C1Cc2ccccc2C1 |
| InChI | InChI=1S/C24H27N3O2/c28-22-24(20-10-12-25-13-11-20,16-17-6-2-1-3-7-17)26-23(29)27(22)21-14-18-8-4-5-9-19(18)15-21/h1-9,20-21,25H,10-16H2,(H,26,29)/t24-/m1/s1 |
| InChIKey | ORGKEMRVBRQWFR-XMMPIXPASA-N |
| XLogP | 2.69 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|