C19H26FN3O2 — CID 95216752
(5S)-3-(2-fluoroethyl)-5-(3-phenylpropyl)-5-piperidin-4-ylimidazolidine-2,4-dione (PubChem CID 95216752) has the molecular formula C19H26FN3O2 and a molecular weight of 347.43 g/mol. Its IUPAC name is (5S)-3-(2-fluoroethyl)-5-(3-phenylpropyl)-5-piperidin-4-ylimidazolidine-2,4-dione.
| Compound Name | (5S)-3-(2-fluoroethyl)-5-(3-phenylpropyl)-5-piperidin-4-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 95216752 |
| Molecular Formula | C19H26FN3O2 |
| Molecular Weight | 347.43 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | (5S)-3-(2-fluoroethyl)-5-(3-phenylpropyl)-5-piperidin-4-ylimidazolidine-2,4-dione |
| SMILES | O=C1N[C@@](CCCc2ccccc2)(C2CCNCC2)C(=O)N1CCF |
| InChI | InChI=1S/C19H26FN3O2/c20-11-14-23-17(24)19(22-18(23)25,16-8-12-21-13-9-16)10-4-7-15-5-2-1-3-6-15/h1-3,5-6,16,21H,4,7-14H2,(H,22,25)/t19-/m0/s1 |
| InChIKey | RGAGKTKOONFZNI-IBGZPJMESA-N |
| XLogP | 2.27 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.43 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|