C15H26FN3O2 — CID 95219594
(5R)-3-(4-fluorobutyl)-5-piperidin-4-yl-5-propylimidazolidine-2,4-dione (PubChem CID 95219594) has the molecular formula C15H26FN3O2 and a molecular weight of 299.39 g/mol. Its IUPAC name is (5R)-3-(4-fluorobutyl)-5-piperidin-4-yl-5-propylimidazolidine-2,4-dione.
| Compound Name | (5R)-3-(4-fluorobutyl)-5-piperidin-4-yl-5-propylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 95219594 |
| Molecular Formula | C15H26FN3O2 |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | (5R)-3-(4-fluorobutyl)-5-piperidin-4-yl-5-propylimidazolidine-2,4-dione |
| SMILES | CCC[C@]1(C2CCNCC2)NC(=O)N(CCCCF)C1=O |
| InChI | InChI=1S/C15H26FN3O2/c1-2-7-15(12-5-9-17-10-6-12)13(20)19(14(21)18-15)11-4-3-8-16/h12,17H,2-11H2,1H3,(H,18,21)/t15-/m1/s1 |
| InChIKey | GIQJMZVGZYLYJT-OAHLLOKOSA-N |
| XLogP | 1.83 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|