C20H29N3O3 — CID 95202564
(5R)-3-(3-hydroxypropyl)-5-(3-phenylpropyl)-5-piperidin-4-ylimidazolidine-2,4-dione (PubChem CID 95202564) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is (5R)-3-(3-hydroxypropyl)-5-(3-phenylpropyl)-5-piperidin-4-ylimidazolidine-2,4-dione.
| Compound Name | (5R)-3-(3-hydroxypropyl)-5-(3-phenylpropyl)-5-piperidin-4-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 95202564 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | (5R)-3-(3-hydroxypropyl)-5-(3-phenylpropyl)-5-piperidin-4-ylimidazolidine-2,4-dione |
| SMILES | O=C1N[C@](CCCc2ccccc2)(C2CCNCC2)C(=O)N1CCCO |
| InChI | InChI=1S/C20H29N3O3/c24-15-5-14-23-18(25)20(22-19(23)26,17-9-12-21-13-10-17)11-4-8-16-6-2-1-3-7-16/h1-3,6-7,17,21,24H,4-5,8-15H2,(H,22,26)/t20-/m1/s1 |
| InChIKey | VFBBTZUZGYWYKJ-HXUWFJFHSA-N |
| XLogP | 1.68 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|