C27H31F2N3O2 — CID 42274167
(5S)-3-cyclopentyl-5-[(4-fluorophenyl)methyl]-5-[1-[(2-fluorophenyl)methyl]piperidin-4-yl]imidazolidine-2,4-dione (PubChem CID 42274167) has the molecular formula C27H31F2N3O2 and a molecular weight of 467.56 g/mol. Its IUPAC name is (5S)-3-cyclopentyl-5-[(4-fluorophenyl)methyl]-5-[1-[(2-fluorophenyl)methyl]piperidin-4-yl]imidazolidine-2,4-dione.
| Compound Name | (5S)-3-cyclopentyl-5-[(4-fluorophenyl)methyl]-5-[1-[(2-fluorophenyl)methyl]piperidin-4-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42274167 |
| Molecular Formula | C27H31F2N3O2 |
| Molecular Weight | 467.56 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | (5S)-3-cyclopentyl-5-[(4-fluorophenyl)methyl]-5-[1-[(2-fluorophenyl)methyl]piperidin-4-yl]imidazolidine-2,4-dione |
| SMILES | O=C1N[C@@](Cc2ccc(F)cc2)(C2CCN(Cc3ccccc3F)CC2)C(=O)N1C1CCCC1 |
| InChI | InChI=1S/C27H31F2N3O2/c28-22-11-9-19(10-12-22)17-27(25(33)32(26(34)30-27)23-6-2-3-7-23)21-13-15-31(16-14-21)18-20-5-1-4-8-24(20)29/h1,4-5,8-12,21,23H,2-3,6-7,13-18H2,(H,30,34)/t27-/m0/s1 |
| InChIKey | DNCXXSQHBMPMOV-MHZLTWQESA-N |
| XLogP | 4.65 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.56 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|