C27H29F2N3O2 — CID 45199955
3-but-2-ynyl-5-[1-[(2,4-difluorophenyl)methyl]piperidin-4-yl]-5-(2-phenylethyl)imidazolidine-2,4-dione (PubChem CID 45199955) has the molecular formula C27H29F2N3O2 and a molecular weight of 465.54 g/mol. Its IUPAC name is 3-but-2-ynyl-5-[1-[(2,4-difluorophenyl)methyl]piperidin-4-yl]-5-(2-phenylethyl)imidazolidine-2,4-dione.
| Compound Name | 3-but-2-ynyl-5-[1-[(2,4-difluorophenyl)methyl]piperidin-4-yl]-5-(2-phenylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 45199955 |
| Molecular Formula | C27H29F2N3O2 |
| Molecular Weight | 465.54 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | 3-but-2-ynyl-5-[1-[(2,4-difluorophenyl)methyl]piperidin-4-yl]-5-(2-phenylethyl)imidazolidine-2,4-dione |
| SMILES | CC#CCN1C(=O)NC(CCc2ccccc2)(C2CCN(Cc3ccc(F)cc3F)CC2)C1=O |
| InChI | InChI=1S/C27H29F2N3O2/c1-2-3-15-32-25(33)27(30-26(32)34,14-11-20-7-5-4-6-8-20)22-12-16-31(17-13-22)19-21-9-10-23(28)18-24(21)29/h4-10,18,22H,11-17,19H2,1H3,(H,30,34) |
| InChIKey | CWGHAKSLMNIVNP-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.54 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|