C30H35N3O3 — CID 45170074
3-but-2-ynyl-5-[1-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperidin-4-yl]-5-(3-phenylpropyl)imidazolidine-2,4-dione (PubChem CID 45170074) has the molecular formula C30H35N3O3 and a molecular weight of 485.63 g/mol. Its IUPAC name is 3-but-2-ynyl-5-[1-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperidin-4-yl]-5-(3-phenylpropyl)imidazolidine-2,4-dione.
| Compound Name | 3-but-2-ynyl-5-[1-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperidin-4-yl]-5-(3-phenylpropyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 45170074 |
| Molecular Formula | C30H35N3O3 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.27 |
| IUPAC Name | 3-but-2-ynyl-5-[1-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperidin-4-yl]-5-(3-phenylpropyl)imidazolidine-2,4-dione |
| SMILES | CC#CCN1C(=O)NC(CCCc2ccccc2)(C2CCN(Cc3ccc4c(c3)CCO4)CC2)C1=O |
| InChI | InChI=1S/C30H35N3O3/c1-2-3-17-33-28(34)30(31-29(33)35,16-7-10-23-8-5-4-6-9-23)26-13-18-32(19-14-26)22-24-11-12-27-25(21-24)15-20-36-27/h4-6,8-9,11-12,21,26H,7,10,13-20,22H2,1H3,(H,31,35) |
| InChIKey | WOKFSWZIPDZKBD-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|