C28H30FN3O3 — CID 45177624
3-but-2-ynyl-5-[1-[2-(3-fluorophenyl)acetyl]piperidin-4-yl]-5-(2-phenylethyl)imidazolidine-2,4-dione (PubChem CID 45177624) has the molecular formula C28H30FN3O3 and a molecular weight of 475.56 g/mol. Its IUPAC name is 3-but-2-ynyl-5-[1-[2-(3-fluorophenyl)acetyl]piperidin-4-yl]-5-(2-phenylethyl)imidazolidine-2,4-dione.
| Compound Name | 3-but-2-ynyl-5-[1-[2-(3-fluorophenyl)acetyl]piperidin-4-yl]-5-(2-phenylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 45177624 |
| Molecular Formula | C28H30FN3O3 |
| Molecular Weight | 475.56 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | 3-but-2-ynyl-5-[1-[2-(3-fluorophenyl)acetyl]piperidin-4-yl]-5-(2-phenylethyl)imidazolidine-2,4-dione |
| SMILES | CC#CCN1C(=O)NC(CCc2ccccc2)(C2CCN(C(=O)Cc3cccc(F)c3)CC2)C1=O |
| InChI | InChI=1S/C28H30FN3O3/c1-2-3-16-32-26(34)28(30-27(32)35,15-12-21-8-5-4-6-9-21)23-13-17-31(18-14-23)25(33)20-22-10-7-11-24(29)19-22/h4-11,19,23H,12-18,20H2,1H3,(H,30,35) |
| InChIKey | ZCTAKXFFLAKBAG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.56 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|