C28H34N4O4 — CID 42343846
(5S)-3-but-2-ynyl-5-[1-[2-(3,5-dimethyl-1,2-oxazol-4-yl)acetyl]piperidin-4-yl]-5-(3-phenylpropyl)imidazolidine-2,4-dione (PubChem CID 42343846) has the molecular formula C28H34N4O4 and a molecular weight of 490.60 g/mol. Its IUPAC name is (5S)-3-but-2-ynyl-5-[1-[2-(3,5-dimethyl-1,2-oxazol-4-yl)acetyl]piperidin-4-yl]-5-(3-phenylpropyl)imidazolidine-2,4-dione.
| Compound Name | (5S)-3-but-2-ynyl-5-[1-[2-(3,5-dimethyl-1,2-oxazol-4-yl)acetyl]piperidin-4-yl]-5-(3-phenylpropyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42343846 |
| Molecular Formula | C28H34N4O4 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | (5S)-3-but-2-ynyl-5-[1-[2-(3,5-dimethyl-1,2-oxazol-4-yl)acetyl]piperidin-4-yl]-5-(3-phenylpropyl)imidazolidine-2,4-dione |
| SMILES | CC#CCN1C(=O)N[C@@](CCCc2ccccc2)(C2CCN(C(=O)Cc3c(C)noc3C)CC2)C1=O |
| InChI | InChI=1S/C28H34N4O4/c1-4-5-16-32-26(34)28(29-27(32)35,15-9-12-22-10-7-6-8-11-22)23-13-17-31(18-14-23)25(33)19-24-20(2)30-36-21(24)3/h6-8,10-11,23H,9,12-19H2,1-3H3,(H,29,35)/t28-/m0/s1 |
| InChIKey | XBLAASGBWMEWSB-NDEPHWFRSA-N |
| XLogP | 3.41 |
| TPSA | 95.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|