C29H35N3O2 — CID 45197542
3-but-2-ynyl-5-(2-phenylethyl)-5-[1-(2-phenylpropyl)piperidin-4-yl]imidazolidine-2,4-dione (PubChem CID 45197542) has the molecular formula C29H35N3O2 and a molecular weight of 457.62 g/mol. Its IUPAC name is 3-but-2-ynyl-5-(2-phenylethyl)-5-[1-(2-phenylpropyl)piperidin-4-yl]imidazolidine-2,4-dione.
| Compound Name | 3-but-2-ynyl-5-(2-phenylethyl)-5-[1-(2-phenylpropyl)piperidin-4-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 45197542 |
| Molecular Formula | C29H35N3O2 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.27 |
| IUPAC Name | 3-but-2-ynyl-5-(2-phenylethyl)-5-[1-(2-phenylpropyl)piperidin-4-yl]imidazolidine-2,4-dione |
| SMILES | CC#CCN1C(=O)NC(CCc2ccccc2)(C2CCN(CC(C)c3ccccc3)CC2)C1=O |
| InChI | InChI=1S/C29H35N3O2/c1-3-4-19-32-27(33)29(30-28(32)34,18-15-24-11-7-5-8-12-24)26-16-20-31(21-17-26)22-23(2)25-13-9-6-10-14-25/h5-14,23,26H,15-22H2,1-2H3,(H,30,34) |
| InChIKey | YWBIVHIXKGMZIU-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|