C23H26FN5O2 — CID 42170064
(5R)-3-but-2-ynyl-5-[(3-fluorophenyl)methyl]-5-[1-(1H-imidazol-2-ylmethyl)piperidin-4-yl]imidazolidine-2,4-dione (PubChem CID 42170064) has the molecular formula C23H26FN5O2 and a molecular weight of 423.49 g/mol. Its IUPAC name is (5R)-3-but-2-ynyl-5-[(3-fluorophenyl)methyl]-5-[1-(1H-imidazol-2-ylmethyl)piperidin-4-yl]imidazolidine-2,4-dione.
| Compound Name | (5R)-3-but-2-ynyl-5-[(3-fluorophenyl)methyl]-5-[1-(1H-imidazol-2-ylmethyl)piperidin-4-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42170064 |
| Molecular Formula | C23H26FN5O2 |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | (5R)-3-but-2-ynyl-5-[(3-fluorophenyl)methyl]-5-[1-(1H-imidazol-2-ylmethyl)piperidin-4-yl]imidazolidine-2,4-dione |
| SMILES | CC#CCN1C(=O)N[C@](Cc2cccc(F)c2)(C2CCN(Cc3ncc[nH]3)CC2)C1=O |
| InChI | InChI=1S/C23H26FN5O2/c1-2-3-11-29-21(30)23(27-22(29)31,15-17-5-4-6-19(24)14-17)18-7-12-28(13-8-18)16-20-25-9-10-26-20/h4-6,9-10,14,18H,7-8,11-13,15-16H2,1H3,(H,25,26)(H,27,31)/t23-/m1/s1 |
| InChIKey | AMGFLBZDUMGUJI-HSZRJFAPSA-N |
| XLogP | 2.32 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|