C24H27F2N3O3 — CID 45193946
5-[1-[(3,5-difluorophenyl)methyl]piperidin-4-yl]-5-[(3-methoxyphenyl)methyl]-3-methylimidazolidine-2,4-dione (PubChem CID 45193946) has the molecular formula C24H27F2N3O3 and a molecular weight of 443.49 g/mol. Its IUPAC name is 5-[1-[(3,5-difluorophenyl)methyl]piperidin-4-yl]-5-[(3-methoxyphenyl)methyl]-3-methylimidazolidine-2,4-dione.
| Compound Name | 5-[1-[(3,5-difluorophenyl)methyl]piperidin-4-yl]-5-[(3-methoxyphenyl)methyl]-3-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 45193946 |
| Molecular Formula | C24H27F2N3O3 |
| Molecular Weight | 443.49 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | 5-[1-[(3,5-difluorophenyl)methyl]piperidin-4-yl]-5-[(3-methoxyphenyl)methyl]-3-methylimidazolidine-2,4-dione |
| SMILES | COc1cccc(CC2(C3CCN(Cc4cc(F)cc(F)c4)CC3)NC(=O)N(C)C2=O)c1 |
| InChI | InChI=1S/C24H27F2N3O3/c1-28-22(30)24(27-23(28)31,14-16-4-3-5-21(12-16)32-2)18-6-8-29(9-7-18)15-17-10-19(25)13-20(26)11-17/h3-5,10-13,18H,6-9,14-15H2,1-2H3,(H,27,31) |
| InChIKey | IYSPNCWPZTYDII-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.49 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|