C31H35N3O3 — CID 45193601
5-[1-(2,2-diphenylethyl)piperidin-4-yl]-5-[(3-methoxyphenyl)methyl]-3-methylimidazolidine-2,4-dione (PubChem CID 45193601) has the molecular formula C31H35N3O3 and a molecular weight of 497.64 g/mol. Its IUPAC name is 5-[1-(2,2-diphenylethyl)piperidin-4-yl]-5-[(3-methoxyphenyl)methyl]-3-methylimidazolidine-2,4-dione.
| Compound Name | 5-[1-(2,2-diphenylethyl)piperidin-4-yl]-5-[(3-methoxyphenyl)methyl]-3-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 45193601 |
| Molecular Formula | C31H35N3O3 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.27 |
| IUPAC Name | 5-[1-(2,2-diphenylethyl)piperidin-4-yl]-5-[(3-methoxyphenyl)methyl]-3-methylimidazolidine-2,4-dione |
| SMILES | COc1cccc(CC2(C3CCN(CC(c4ccccc4)c4ccccc4)CC3)NC(=O)N(C)C2=O)c1 |
| InChI | InChI=1S/C31H35N3O3/c1-33-29(35)31(32-30(33)36,21-23-10-9-15-27(20-23)37-2)26-16-18-34(19-17-26)22-28(24-11-5-3-6-12-24)25-13-7-4-8-14-25/h3-15,20,26,28H,16-19,21-22H2,1-2H3,(H,32,36) |
| InChIKey | UWSUZVNZYAMBMY-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|