C27H36N4O2 — CID 26280199
(5S)-5-benzyl-5-[1-[(2S)-2-methylbutyl]piperidin-4-yl]-3-(2-pyridin-2-ylethyl)imidazolidine-2,4-dione (PubChem CID 26280199) has the molecular formula C27H36N4O2 and a molecular weight of 448.61 g/mol. Its IUPAC name is (5S)-5-benzyl-5-[1-[(2S)-2-methylbutyl]piperidin-4-yl]-3-(2-pyridin-2-ylethyl)imidazolidine-2,4-dione.
| Compound Name | (5S)-5-benzyl-5-[1-[(2S)-2-methylbutyl]piperidin-4-yl]-3-(2-pyridin-2-ylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 26280199 |
| Molecular Formula | C27H36N4O2 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | (5S)-5-benzyl-5-[1-[(2S)-2-methylbutyl]piperidin-4-yl]-3-(2-pyridin-2-ylethyl)imidazolidine-2,4-dione |
| SMILES | CC[C@H](C)CN1CCC([C@]2(Cc3ccccc3)NC(=O)N(CCc3ccccn3)C2=O)CC1 |
| InChI | InChI=1S/C27H36N4O2/c1-3-21(2)20-30-16-12-23(13-17-30)27(19-22-9-5-4-6-10-22)25(32)31(26(33)29-27)18-14-24-11-7-8-15-28-24/h4-11,15,21,23H,3,12-14,16-20H2,1-2H3,(H,29,33)/t21-,27-/m0/s1 |
| InChIKey | NWSPIOMSIRSXIV-IDISGSTGSA-N |
| XLogP | 3.92 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|