C26H30N4O4 — CID 118754184
5-[1-(2-oxo-2-phenylacetyl)piperidin-4-yl]-5-propyl-3-(2-pyridin-2-ylethyl)imidazolidine-2,4-dione (PubChem CID 118754184) has the molecular formula C26H30N4O4 and a molecular weight of 462.55 g/mol. Its IUPAC name is 5-[1-(2-oxo-2-phenylacetyl)piperidin-4-yl]-5-propyl-3-(2-pyridin-2-ylethyl)imidazolidine-2,4-dione.
| Compound Name | 5-[1-(2-oxo-2-phenylacetyl)piperidin-4-yl]-5-propyl-3-(2-pyridin-2-ylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 118754184 |
| Molecular Formula | C26H30N4O4 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | 5-[1-(2-oxo-2-phenylacetyl)piperidin-4-yl]-5-propyl-3-(2-pyridin-2-ylethyl)imidazolidine-2,4-dione |
| SMILES | CCCC1(C2CCN(C(=O)C(=O)c3ccccc3)CC2)NC(=O)N(CCc2ccccn2)C1=O |
| InChI | InChI=1S/C26H30N4O4/c1-2-14-26(24(33)30(25(34)28-26)18-13-21-10-6-7-15-27-21)20-11-16-29(17-12-20)23(32)22(31)19-8-4-3-5-9-19/h3-10,15,20H,2,11-14,16-18H2,1H3,(H,28,34) |
| InChIKey | WFQUXDGZGLEEGN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|