C28H37N3O3S — CID 26278568
(5R)-5-[1-(4-tert-butylbenzoyl)piperidin-4-yl]-5-propyl-3-(2-thiophen-2-ylethyl)imidazolidine-2,4-dione (PubChem CID 26278568) has the molecular formula C28H37N3O3S and a molecular weight of 495.69 g/mol. Its IUPAC name is (5R)-5-[1-(4-tert-butylbenzoyl)piperidin-4-yl]-5-propyl-3-(2-thiophen-2-ylethyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[1-(4-tert-butylbenzoyl)piperidin-4-yl]-5-propyl-3-(2-thiophen-2-ylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 26278568 |
| Molecular Formula | C28H37N3O3S |
| Molecular Weight | 495.69 g/mol |
| Exact Mass | 495.26 |
| IUPAC Name | (5R)-5-[1-(4-tert-butylbenzoyl)piperidin-4-yl]-5-propyl-3-(2-thiophen-2-ylethyl)imidazolidine-2,4-dione |
| SMILES | CCC[C@]1(C2CCN(C(=O)c3ccc(C(C)(C)C)cc3)CC2)NC(=O)N(CCc2cccs2)C1=O |
| InChI | InChI=1S/C28H37N3O3S/c1-5-15-28(25(33)31(26(34)29-28)18-14-23-7-6-19-35-23)22-12-16-30(17-13-22)24(32)20-8-10-21(11-9-20)27(2,3)4/h6-11,19,22H,5,12-18H2,1-4H3,(H,29,34)/t28-/m1/s1 |
| InChIKey | VGDYGGKQLABLLI-MUUNZHRXSA-N |
| XLogP | 5.23 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.69 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|