C25H31N3O4S — CID 42373156
(5S)-5-[1-(4-methoxybenzoyl)piperidin-4-yl]-5-propyl-3-(2-thiophen-2-ylethyl)imidazolidine-2,4-dione (PubChem CID 42373156) has the molecular formula C25H31N3O4S and a molecular weight of 469.61 g/mol. Its IUPAC name is (5S)-5-[1-(4-methoxybenzoyl)piperidin-4-yl]-5-propyl-3-(2-thiophen-2-ylethyl)imidazolidine-2,4-dione.
| Compound Name | (5S)-5-[1-(4-methoxybenzoyl)piperidin-4-yl]-5-propyl-3-(2-thiophen-2-ylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42373156 |
| Molecular Formula | C25H31N3O4S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | (5S)-5-[1-(4-methoxybenzoyl)piperidin-4-yl]-5-propyl-3-(2-thiophen-2-ylethyl)imidazolidine-2,4-dione |
| SMILES | CCC[C@@]1(C2CCN(C(=O)c3ccc(OC)cc3)CC2)NC(=O)N(CCc2cccs2)C1=O |
| InChI | InChI=1S/C25H31N3O4S/c1-3-13-25(23(30)28(24(31)26-25)16-12-21-5-4-17-33-21)19-10-14-27(15-11-19)22(29)18-6-8-20(32-2)9-7-18/h4-9,17,19H,3,10-16H2,1-2H3,(H,26,31)/t25-/m0/s1 |
| InChIKey | TXXCVBFPAWFOTH-VWLOTQADSA-N |
| XLogP | 3.94 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|