C27H33ClN4O3 — CID 45216723
5-[1-(4-chlorobenzoyl)piperidin-4-yl]-3-[2-(dimethylamino)ethyl]-5-(2-phenylethyl)imidazolidine-2,4-dione (PubChem CID 45216723) has the molecular formula C27H33ClN4O3 and a molecular weight of 497.04 g/mol. Its IUPAC name is 5-[1-(4-chlorobenzoyl)piperidin-4-yl]-3-[2-(dimethylamino)ethyl]-5-(2-phenylethyl)imidazolidine-2,4-dione.
| Compound Name | 5-[1-(4-chlorobenzoyl)piperidin-4-yl]-3-[2-(dimethylamino)ethyl]-5-(2-phenylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 45216723 |
| Molecular Formula | C27H33ClN4O3 |
| Molecular Weight | 497.04 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | 5-[1-(4-chlorobenzoyl)piperidin-4-yl]-3-[2-(dimethylamino)ethyl]-5-(2-phenylethyl)imidazolidine-2,4-dione |
| SMILES | CN(C)CCN1C(=O)NC(CCc2ccccc2)(C2CCN(C(=O)c3ccc(Cl)cc3)CC2)C1=O |
| InChI | InChI=1S/C27H33ClN4O3/c1-30(2)18-19-32-25(34)27(29-26(32)35,15-12-20-6-4-3-5-7-20)22-13-16-31(17-14-22)24(33)21-8-10-23(28)11-9-21/h3-11,22H,12-19H2,1-2H3,(H,29,35) |
| InChIKey | QIPVZXHQPSNUQZ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.04 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|