C27H32F2N4O3 — CID 42406087
(5S)-5-[1-(3,4-difluorobenzoyl)piperidin-4-yl]-3-[2-(dimethylamino)ethyl]-5-(2-phenylethyl)imidazolidine-2,4-dione (PubChem CID 42406087) has the molecular formula C27H32F2N4O3 and a molecular weight of 498.57 g/mol. Its IUPAC name is (5S)-5-[1-(3,4-difluorobenzoyl)piperidin-4-yl]-3-[2-(dimethylamino)ethyl]-5-(2-phenylethyl)imidazolidine-2,4-dione.
| Compound Name | (5S)-5-[1-(3,4-difluorobenzoyl)piperidin-4-yl]-3-[2-(dimethylamino)ethyl]-5-(2-phenylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42406087 |
| Molecular Formula | C27H32F2N4O3 |
| Molecular Weight | 498.57 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | (5S)-5-[1-(3,4-difluorobenzoyl)piperidin-4-yl]-3-[2-(dimethylamino)ethyl]-5-(2-phenylethyl)imidazolidine-2,4-dione |
| SMILES | CN(C)CCN1C(=O)N[C@@](CCc2ccccc2)(C2CCN(C(=O)c3ccc(F)c(F)c3)CC2)C1=O |
| InChI | InChI=1S/C27H32F2N4O3/c1-31(2)16-17-33-25(35)27(30-26(33)36,13-10-19-6-4-3-5-7-19)21-11-14-32(15-12-21)24(34)20-8-9-22(28)23(29)18-20/h3-9,18,21H,10-17H2,1-2H3,(H,30,36)/t27-/m0/s1 |
| InChIKey | FSGANHHLBCASES-MHZLTWQESA-N |
| XLogP | 3.30 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.57 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|