C24H31FN4O3 — CID 26327120
(5S)-5-(1-but-2-ynoylpiperidin-4-yl)-3-[3-(dimethylamino)propyl]-5-[(3-fluorophenyl)methyl]imidazolidine-2,4-dione (PubChem CID 26327120) has the molecular formula C24H31FN4O3 and a molecular weight of 442.54 g/mol. Its IUPAC name is (5S)-5-(1-but-2-ynoylpiperidin-4-yl)-3-[3-(dimethylamino)propyl]-5-[(3-fluorophenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-(1-but-2-ynoylpiperidin-4-yl)-3-[3-(dimethylamino)propyl]-5-[(3-fluorophenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 26327120 |
| Molecular Formula | C24H31FN4O3 |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | (5S)-5-(1-but-2-ynoylpiperidin-4-yl)-3-[3-(dimethylamino)propyl]-5-[(3-fluorophenyl)methyl]imidazolidine-2,4-dione |
| SMILES | CC#CC(=O)N1CCC([C@]2(Cc3cccc(F)c3)NC(=O)N(CCCN(C)C)C2=O)CC1 |
| InChI | InChI=1S/C24H31FN4O3/c1-4-7-21(30)28-14-10-19(11-15-28)24(17-18-8-5-9-20(25)16-18)22(31)29(23(32)26-24)13-6-12-27(2)3/h5,8-9,16,19H,6,10-15,17H2,1-3H3,(H,26,32)/t24-/m0/s1 |
| InChIKey | WAIXOOKOLNCVLX-DEOSSOPVSA-N |
| XLogP | 1.87 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|