C26H37FN4O3 — CID 42275547
(5R)-3-[3-(dimethylamino)propyl]-5-[(3-fluorophenyl)methyl]-5-[1-[(E)-4-methylpent-2-enoyl]piperidin-4-yl]imidazolidine-2,4-dione (PubChem CID 42275547) has the molecular formula C26H37FN4O3 and a molecular weight of 472.61 g/mol. Its IUPAC name is (5R)-3-[3-(dimethylamino)propyl]-5-[(3-fluorophenyl)methyl]-5-[1-[(E)-4-methylpent-2-enoyl]piperidin-4-yl]imidazolidine-2,4-dione.
| Compound Name | (5R)-3-[3-(dimethylamino)propyl]-5-[(3-fluorophenyl)methyl]-5-[1-[(E)-4-methylpent-2-enoyl]piperidin-4-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42275547 |
| Molecular Formula | C26H37FN4O3 |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | (5R)-3-[3-(dimethylamino)propyl]-5-[(3-fluorophenyl)methyl]-5-[1-[(E)-4-methylpent-2-enoyl]piperidin-4-yl]imidazolidine-2,4-dione |
| SMILES | CC(C)/C=C/C(=O)N1CCC([C@@]2(Cc3cccc(F)c3)NC(=O)N(CCCN(C)C)C2=O)CC1 |
| InChI | InChI=1S/C26H37FN4O3/c1-19(2)9-10-23(32)30-15-11-21(12-16-30)26(18-20-7-5-8-22(27)17-20)24(33)31(25(34)28-26)14-6-13-29(3)4/h5,7-10,17,19,21H,6,11-16,18H2,1-4H3,(H,28,34)/b10-9+/t26-/m1/s1 |
| InChIKey | ZNMSEFUERMLBMQ-ZMXFDXOUSA-N |
| XLogP | 3.06 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|