C26H31FN4O3S — CID 42434168
(5R)-3-[2-(dimethylamino)ethyl]-5-[(3-fluorophenyl)methyl]-5-[1-[(E)-3-thiophen-2-ylprop-2-enoyl]piperidin-4-yl]imidazolidine-2,4-dione (PubChem CID 42434168) has the molecular formula C26H31FN4O3S and a molecular weight of 498.62 g/mol. Its IUPAC name is (5R)-3-[2-(dimethylamino)ethyl]-5-[(3-fluorophenyl)methyl]-5-[1-[(E)-3-thiophen-2-ylprop-2-enoyl]piperidin-4-yl]imidazolidine-2,4-dione.
| Compound Name | (5R)-3-[2-(dimethylamino)ethyl]-5-[(3-fluorophenyl)methyl]-5-[1-[(E)-3-thiophen-2-ylprop-2-enoyl]piperidin-4-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42434168 |
| Molecular Formula | C26H31FN4O3S |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | (5R)-3-[2-(dimethylamino)ethyl]-5-[(3-fluorophenyl)methyl]-5-[1-[(E)-3-thiophen-2-ylprop-2-enoyl]piperidin-4-yl]imidazolidine-2,4-dione |
| SMILES | CN(C)CCN1C(=O)N[C@](Cc2cccc(F)c2)(C2CCN(C(=O)/C=C/c3cccs3)CC2)C1=O |
| InChI | InChI=1S/C26H31FN4O3S/c1-29(2)14-15-31-24(33)26(28-25(31)34,18-19-5-3-6-21(27)17-19)20-10-12-30(13-11-20)23(32)9-8-22-7-4-16-35-22/h3-9,16-17,20H,10-15,18H2,1-2H3,(H,28,34)/b9-8+/t26-/m1/s1 |
| InChIKey | CWZNKGLNOHGMPV-ZPLOFBHDSA-N |
| XLogP | 3.23 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|