C27H33FN4O3 — CID 42465176
(5R)-3-[2-(dimethylamino)ethyl]-5-[1-(2-fluorobenzoyl)piperidin-4-yl]-5-(2-phenylethyl)imidazolidine-2,4-dione (PubChem CID 42465176) has the molecular formula C27H33FN4O3 and a molecular weight of 480.58 g/mol. Its IUPAC name is (5R)-3-[2-(dimethylamino)ethyl]-5-[1-(2-fluorobenzoyl)piperidin-4-yl]-5-(2-phenylethyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-3-[2-(dimethylamino)ethyl]-5-[1-(2-fluorobenzoyl)piperidin-4-yl]-5-(2-phenylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42465176 |
| Molecular Formula | C27H33FN4O3 |
| Molecular Weight | 480.58 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | (5R)-3-[2-(dimethylamino)ethyl]-5-[1-(2-fluorobenzoyl)piperidin-4-yl]-5-(2-phenylethyl)imidazolidine-2,4-dione |
| SMILES | CN(C)CCN1C(=O)N[C@](CCc2ccccc2)(C2CCN(C(=O)c3ccccc3F)CC2)C1=O |
| InChI | InChI=1S/C27H33FN4O3/c1-30(2)18-19-32-25(34)27(29-26(32)35,15-12-20-8-4-3-5-9-20)21-13-16-31(17-14-21)24(33)22-10-6-7-11-23(22)28/h3-11,21H,12-19H2,1-2H3,(H,29,35)/t27-/m1/s1 |
| InChIKey | MVSWWCFVQQOCKR-HHHXNRCGSA-N |
| XLogP | 3.16 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.58 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|