C24H32ClN3O4 — CID 74803749
5-[(2-chlorophenyl)methyl]-3-(2-methoxyethyl)-5-[1-(4-methylpent-2-enoyl)piperidin-4-yl]imidazolidine-2,4-dione (PubChem CID 74803749) has the molecular formula C24H32ClN3O4 and a molecular weight of 461.99 g/mol. Its IUPAC name is 5-[(2-chlorophenyl)methyl]-3-(2-methoxyethyl)-5-[1-(4-methylpent-2-enoyl)piperidin-4-yl]imidazolidine-2,4-dione.
| Compound Name | 5-[(2-chlorophenyl)methyl]-3-(2-methoxyethyl)-5-[1-(4-methylpent-2-enoyl)piperidin-4-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 74803749 |
| Molecular Formula | C24H32ClN3O4 |
| Molecular Weight | 461.99 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | 5-[(2-chlorophenyl)methyl]-3-(2-methoxyethyl)-5-[1-(4-methylpent-2-enoyl)piperidin-4-yl]imidazolidine-2,4-dione |
| SMILES | COCCN1C(=O)NC(Cc2ccccc2Cl)(C2CCN(C(=O)C=CC(C)C)CC2)C1=O |
| InChI | InChI=1S/C24H32ClN3O4/c1-17(2)8-9-21(29)27-12-10-19(11-13-27)24(16-18-6-4-5-7-20(18)25)22(30)28(14-15-32-3)23(31)26-24/h4-9,17,19H,10-16H2,1-3H3,(H,26,31) |
| InChIKey | JGPUILSZNPAPCY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.99 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|