C27H32ClN3O4 — CID 42466806
(5S)-5-[(2-chlorophenyl)methyl]-3-(cyclopropylmethyl)-5-[1-[(2-hydroxy-4-methoxyphenyl)methyl]piperidin-4-yl]imidazolidine-2,4-dione (PubChem CID 42466806) has the molecular formula C27H32ClN3O4 and a molecular weight of 498.02 g/mol. Its IUPAC name is (5S)-5-[(2-chlorophenyl)methyl]-3-(cyclopropylmethyl)-5-[1-[(2-hydroxy-4-methoxyphenyl)methyl]piperidin-4-yl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-[(2-chlorophenyl)methyl]-3-(cyclopropylmethyl)-5-[1-[(2-hydroxy-4-methoxyphenyl)methyl]piperidin-4-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42466806 |
| Molecular Formula | C27H32ClN3O4 |
| Molecular Weight | 498.02 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | (5S)-5-[(2-chlorophenyl)methyl]-3-(cyclopropylmethyl)-5-[1-[(2-hydroxy-4-methoxyphenyl)methyl]piperidin-4-yl]imidazolidine-2,4-dione |
| SMILES | COc1ccc(CN2CCC([C@]3(Cc4ccccc4Cl)NC(=O)N(CC4CC4)C3=O)CC2)c(O)c1 |
| InChI | InChI=1S/C27H32ClN3O4/c1-35-22-9-8-20(24(32)14-22)17-30-12-10-21(11-13-30)27(15-19-4-2-3-5-23(19)28)25(33)31(26(34)29-27)16-18-6-7-18/h2-5,8-9,14,18,21,32H,6-7,10-13,15-17H2,1H3,(H,29,34)/t27-/m0/s1 |
| InChIKey | AZKVXJFNPMZAQX-MHZLTWQESA-N |
| XLogP | 4.21 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.02 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|