C25H32N4O3S — CID 45239892
5-propyl-3-(2-pyridin-2-ylethyl)-5-[1-(3-thiophen-2-ylpropanoyl)piperidin-4-yl]imidazolidine-2,4-dione (PubChem CID 45239892) has the molecular formula C25H32N4O3S and a molecular weight of 468.62 g/mol. Its IUPAC name is 5-propyl-3-(2-pyridin-2-ylethyl)-5-[1-(3-thiophen-2-ylpropanoyl)piperidin-4-yl]imidazolidine-2,4-dione.
| Compound Name | 5-propyl-3-(2-pyridin-2-ylethyl)-5-[1-(3-thiophen-2-ylpropanoyl)piperidin-4-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 45239892 |
| Molecular Formula | C25H32N4O3S |
| Molecular Weight | 468.62 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | 5-propyl-3-(2-pyridin-2-ylethyl)-5-[1-(3-thiophen-2-ylpropanoyl)piperidin-4-yl]imidazolidine-2,4-dione |
| SMILES | CCCC1(C2CCN(C(=O)CCc3cccs3)CC2)NC(=O)N(CCc2ccccn2)C1=O |
| InChI | InChI=1S/C25H32N4O3S/c1-2-13-25(23(31)29(24(32)27-25)17-12-20-6-3-4-14-26-20)19-10-15-28(16-11-19)22(30)9-8-21-7-5-18-33-21/h3-7,14,18-19H,2,8-13,15-17H2,1H3,(H,27,32) |
| InChIKey | VOXLAWQSLGQIPH-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.62 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|