C27H36N4O5 — CID 45195401
3-(oxolan-2-ylmethyl)-5-[1-[4-(2-oxopyrrolidin-1-yl)benzoyl]piperidin-4-yl]-5-propylimidazolidine-2,4-dione (PubChem CID 45195401) has the molecular formula C27H36N4O5 and a molecular weight of 496.61 g/mol. Its IUPAC name is 3-(oxolan-2-ylmethyl)-5-[1-[4-(2-oxopyrrolidin-1-yl)benzoyl]piperidin-4-yl]-5-propylimidazolidine-2,4-dione.
| Compound Name | 3-(oxolan-2-ylmethyl)-5-[1-[4-(2-oxopyrrolidin-1-yl)benzoyl]piperidin-4-yl]-5-propylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 45195401 |
| Molecular Formula | C27H36N4O5 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.27 |
| IUPAC Name | 3-(oxolan-2-ylmethyl)-5-[1-[4-(2-oxopyrrolidin-1-yl)benzoyl]piperidin-4-yl]-5-propylimidazolidine-2,4-dione |
| SMILES | CCCC1(C2CCN(C(=O)c3ccc(N4CCCC4=O)cc3)CC2)NC(=O)N(CC2CCCO2)C1=O |
| InChI | InChI=1S/C27H36N4O5/c1-2-13-27(25(34)31(26(35)28-27)18-22-5-4-17-36-22)20-11-15-29(16-12-20)24(33)19-7-9-21(10-8-19)30-14-3-6-23(30)32/h7-10,20,22H,2-6,11-18H2,1H3,(H,28,35) |
| InChIKey | ZRPHMECSDKNLSG-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|