C23H32ClN3O4 — CID 45183182
5-[1-[(3-chloro-4-hydroxyphenyl)methyl]piperidin-4-yl]-3-(oxolan-2-ylmethyl)-5-propylimidazolidine-2,4-dione (PubChem CID 45183182) has the molecular formula C23H32ClN3O4 and a molecular weight of 449.98 g/mol. Its IUPAC name is 5-[1-[(3-chloro-4-hydroxyphenyl)methyl]piperidin-4-yl]-3-(oxolan-2-ylmethyl)-5-propylimidazolidine-2,4-dione.
| Compound Name | 5-[1-[(3-chloro-4-hydroxyphenyl)methyl]piperidin-4-yl]-3-(oxolan-2-ylmethyl)-5-propylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 45183182 |
| Molecular Formula | C23H32ClN3O4 |
| Molecular Weight | 449.98 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | 5-[1-[(3-chloro-4-hydroxyphenyl)methyl]piperidin-4-yl]-3-(oxolan-2-ylmethyl)-5-propylimidazolidine-2,4-dione |
| SMILES | CCCC1(C2CCN(Cc3ccc(O)c(Cl)c3)CC2)NC(=O)N(CC2CCCO2)C1=O |
| InChI | InChI=1S/C23H32ClN3O4/c1-2-9-23(21(29)27(22(30)25-23)15-18-4-3-12-31-18)17-7-10-26(11-8-17)14-16-5-6-20(28)19(24)13-16/h5-6,13,17-18,28H,2-4,7-12,14-15H2,1H3,(H,25,30) |
| InChIKey | YLIYXTZDXDSLQL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.98 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|