C25H37N3O5 — CID 42246851
(5S)-5-[1-[(3-ethoxy-2-hydroxyphenyl)methyl]piperidin-4-yl]-3-[[(2S)-oxolan-2-yl]methyl]-5-propylimidazolidine-2,4-dione (PubChem CID 42246851) has the molecular formula C25H37N3O5 and a molecular weight of 459.59 g/mol. Its IUPAC name is (5S)-5-[1-[(3-ethoxy-2-hydroxyphenyl)methyl]piperidin-4-yl]-3-[[(2S)-oxolan-2-yl]methyl]-5-propylimidazolidine-2,4-dione.
| Compound Name | (5S)-5-[1-[(3-ethoxy-2-hydroxyphenyl)methyl]piperidin-4-yl]-3-[[(2S)-oxolan-2-yl]methyl]-5-propylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42246851 |
| Molecular Formula | C25H37N3O5 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.27 |
| IUPAC Name | (5S)-5-[1-[(3-ethoxy-2-hydroxyphenyl)methyl]piperidin-4-yl]-3-[[(2S)-oxolan-2-yl]methyl]-5-propylimidazolidine-2,4-dione |
| SMILES | CCC[C@@]1(C2CCN(Cc3cccc(OCC)c3O)CC2)NC(=O)N(C[C@@H]2CCCO2)C1=O |
| InChI | InChI=1S/C25H37N3O5/c1-3-12-25(23(30)28(24(31)26-25)17-20-8-6-15-33-20)19-10-13-27(14-11-19)16-18-7-5-9-21(22(18)29)32-4-2/h5,7,9,19-20,29H,3-4,6,8,10-17H2,1-2H3,(H,26,31)/t20-,25-/m0/s1 |
| InChIKey | HPVSLFULVWGRIP-CPJSRVTESA-N |
| XLogP | 3.27 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|