C26H40N4O4 — CID 45221618
5-[1-[(2-hydroxy-3-methoxyphenyl)methyl]piperidin-4-yl]-3-[2-(1-methylpyrrolidin-2-yl)ethyl]-5-propylimidazolidine-2,4-dione (PubChem CID 45221618) has the molecular formula C26H40N4O4 and a molecular weight of 472.63 g/mol. Its IUPAC name is 5-[1-[(2-hydroxy-3-methoxyphenyl)methyl]piperidin-4-yl]-3-[2-(1-methylpyrrolidin-2-yl)ethyl]-5-propylimidazolidine-2,4-dione.
| Compound Name | 5-[1-[(2-hydroxy-3-methoxyphenyl)methyl]piperidin-4-yl]-3-[2-(1-methylpyrrolidin-2-yl)ethyl]-5-propylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 45221618 |
| Molecular Formula | C26H40N4O4 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.30 |
| IUPAC Name | 5-[1-[(2-hydroxy-3-methoxyphenyl)methyl]piperidin-4-yl]-3-[2-(1-methylpyrrolidin-2-yl)ethyl]-5-propylimidazolidine-2,4-dione |
| SMILES | CCCC1(C2CCN(Cc3cccc(OC)c3O)CC2)NC(=O)N(CCC2CCCN2C)C1=O |
| InChI | InChI=1S/C26H40N4O4/c1-4-13-26(24(32)30(25(33)27-26)17-12-21-8-6-14-28(21)2)20-10-15-29(16-11-20)18-19-7-5-9-22(34-3)23(19)31/h5,7,9,20-21,31H,4,6,8,10-18H2,1-3H3,(H,27,33) |
| InChIKey | YEDXYULTFMLHHE-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|