C24H30N4O3S — CID 42167678
(5R)-5-(3-methylbutyl)-3-(pyridin-2-ylmethyl)-5-[1-(thiophene-3-carbonyl)piperidin-4-yl]imidazolidine-2,4-dione (PubChem CID 42167678) has the molecular formula C24H30N4O3S and a molecular weight of 454.60 g/mol. Its IUPAC name is (5R)-5-(3-methylbutyl)-3-(pyridin-2-ylmethyl)-5-[1-(thiophene-3-carbonyl)piperidin-4-yl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-(3-methylbutyl)-3-(pyridin-2-ylmethyl)-5-[1-(thiophene-3-carbonyl)piperidin-4-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42167678 |
| Molecular Formula | C24H30N4O3S |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | (5R)-5-(3-methylbutyl)-3-(pyridin-2-ylmethyl)-5-[1-(thiophene-3-carbonyl)piperidin-4-yl]imidazolidine-2,4-dione |
| SMILES | CC(C)CC[C@]1(C2CCN(C(=O)c3ccsc3)CC2)NC(=O)N(Cc2ccccn2)C1=O |
| InChI | InChI=1S/C24H30N4O3S/c1-17(2)6-10-24(19-7-12-27(13-8-19)21(29)18-9-14-32-16-18)22(30)28(23(31)26-24)15-20-5-3-4-11-25-20/h3-5,9,11,14,16-17,19H,6-8,10,12-13,15H2,1-2H3,(H,26,31)/t24-/m1/s1 |
| InChIKey | GPJNFIYLYXADDZ-XMMPIXPASA-N |
| XLogP | 3.92 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|